C26H33FN4O2 — CID 53240100
(2S,4S,5S)-5-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-2-(4-methoxyphenyl)piperidin-4-ol (PubChem CID 53240100) has the molecular formula C26H33FN4O2 and a molecular weight of 452.57 g/mol. Its IUPAC name is (2S,4S,5S)-5-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-2-(4-methoxyphenyl)piperidin-4-ol.
| Compound Name | (2S,4S,5S)-5-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-2-(4-methoxyphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 53240100 |
| Molecular Formula | C26H33FN4O2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2S,4S,5S)-5-[4-(4-fluorophenyl)triazol-1-yl]-1-hexyl-2-(4-methoxyphenyl)piperidin-4-ol |
| SMILES | CCCCCCN1C[C@H](n2cc(-c3ccc(F)cc3)nn2)[C@@H](O)C[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H33FN4O2/c1-3-4-5-6-15-30-18-25(26(32)16-24(30)20-9-13-22(33-2)14-10-20)31-17-23(28-29-31)19-7-11-21(27)12-8-19/h7-14,17,24-26,32H,3-6,15-16,18H2,1-2H3/t24-,25-,26-/m0/s1 |
| InChIKey | AMHBLMLCVBICGA-GSDHBNRESA-N |
| XLogP | 5.02 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|