C22H27BrFN3O5S — CID 46903709
1-[[(4S,5R)-8-bromo-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(3-fluorophenyl)-1-methylurea (PubChem CID 46903709) has the molecular formula C22H27BrFN3O5S and a molecular weight of 544.44 g/mol. Its IUPAC name is 1-[[(4S,5R)-8-bromo-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(3-fluorophenyl)-1-methylurea.
| Compound Name | 1-[[(4S,5R)-8-bromo-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(3-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 46903709 |
| Molecular Formula | C22H27BrFN3O5S |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | 1-[[(4S,5R)-8-bromo-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-3-(3-fluorophenyl)-1-methylurea |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@H](CN(C)C(=O)Nc2cccc(F)c2)Oc2cc(Br)ccc2S1(=O)=O |
| InChI | InChI=1S/C22H27BrFN3O5S/c1-14-11-27(15(2)13-28)33(30,31)21-8-7-16(23)9-19(21)32-20(14)12-26(3)22(29)25-18-6-4-5-17(24)10-18/h4-10,14-15,20,28H,11-13H2,1-3H3,(H,25,29)/t14-,15+,20-/m0/s1 |
| InChIKey | DBUNSMGOUKNDFR-MDOVXXIYSA-N |
| XLogP | 3.52 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |