C25H28O6 — CID 46906618
5-(cyclohexylmethoxy)-3-(2,3,4-trimethoxyphenyl)chromen-4-one (PubChem CID 46906618) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 5-(cyclohexylmethoxy)-3-(2,3,4-trimethoxyphenyl)chromen-4-one.
| Compound Name | 5-(cyclohexylmethoxy)-3-(2,3,4-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 46906618 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 5-(cyclohexylmethoxy)-3-(2,3,4-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2coc3cccc(OCC4CCCCC4)c3c2=O)c(OC)c1OC |
| InChI | InChI=1S/C25H28O6/c1-27-21-13-12-17(24(28-2)25(21)29-3)18-15-31-20-11-7-10-19(22(20)23(18)26)30-14-16-8-5-4-6-9-16/h7,10-13,15-16H,4-6,8-9,14H2,1-3H3 |
| InChIKey | WXWMNLSDPLUBPN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |