C19H18N2O4S3 — CID 46908086
N,N-dimethyl-3-[(4Z)-1-oxo-4-thiophen-2-ylsulfonyliminonaphthalen-2-yl]sulfanylpropanamide (PubChem CID 46908086) has the molecular formula C19H18N2O4S3 and a molecular weight of 434.56 g/mol. Its IUPAC name is N,N-dimethyl-3-[(4Z)-1-oxo-4-thiophen-2-ylsulfonyliminonaphthalen-2-yl]sulfanylpropanamide.
| Compound Name | N,N-dimethyl-3-[(4Z)-1-oxo-4-thiophen-2-ylsulfonyliminonaphthalen-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 46908086 |
| Molecular Formula | C19H18N2O4S3 |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | N,N-dimethyl-3-[(4Z)-1-oxo-4-thiophen-2-ylsulfonyliminonaphthalen-2-yl]sulfanylpropanamide |
| SMILES | CN(C)C(=O)CCSC1=C/C(=N/S(=O)(=O)c2cccs2)c2ccccc2C1=O |
| InChI | InChI=1S/C19H18N2O4S3/c1-21(2)17(22)9-11-26-16-12-15(13-6-3-4-7-14(13)19(16)23)20-28(24,25)18-8-5-10-27-18/h3-8,10,12H,9,11H2,1-2H3/b20-15- |
| InChIKey | ODPGLPBUVAETSJ-HKWRFOASSA-N |
| XLogP | 3.22 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|