C13H14N2O2S2 — CID 75459336
N,N-dimethyl-N'-thiophen-2-ylsulfonylbenzenecarboximidamide (PubChem CID 75459336) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is N,N-dimethyl-N'-thiophen-2-ylsulfonylbenzenecarboximidamide.
| Compound Name | N,N-dimethyl-N'-thiophen-2-ylsulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 75459336 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | N,N-dimethyl-N'-thiophen-2-ylsulfonylbenzenecarboximidamide |
| SMILES | CN(C)/C(=N/S(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O2S2/c1-15(2)13(11-7-4-3-5-8-11)14-19(16,17)12-9-6-10-18-12/h3-10H,1-2H3/b14-13+ |
| InChIKey | VKPAALSISDVZLM-BUHFOSPRSA-N |
| XLogP | 2.45 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|