C20H18N2O2S2 — CID 2317504
N-[3,4-dihydro-2H-quinolin-1-yl(phenyl)methylidene]thiophene-2-sulfonamide (PubChem CID 2317504) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[3,4-dihydro-2H-quinolin-1-yl(phenyl)methylidene]thiophene-2-sulfonamide.
| Compound Name | N-[3,4-dihydro-2H-quinolin-1-yl(phenyl)methylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2317504 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[3,4-dihydro-2H-quinolin-1-yl(phenyl)methylidene]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N=C(c1ccccc1)N1CCCc2ccccc21)c1cccs1 |
| InChI | InChI=1S/C20H18N2O2S2/c23-26(24,19-13-7-15-25-19)21-20(17-9-2-1-3-10-17)22-14-6-11-16-8-4-5-12-18(16)22/h1-5,7-10,12-13,15H,6,11,14H2 |
| InChIKey | LUPZDHPOWIMUKE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|