C14H11N3O2S3 — CID 2234502
N-(1,3-thiazol-2-yl)-N'-thiophen-2-ylsulfonylbenzenecarboximidamide (PubChem CID 2234502) has the molecular formula C14H11N3O2S3 and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-N'-thiophen-2-ylsulfonylbenzenecarboximidamide.
| Compound Name | N-(1,3-thiazol-2-yl)-N'-thiophen-2-ylsulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 2234502 |
| Molecular Formula | C14H11N3O2S3 |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-N'-thiophen-2-ylsulfonylbenzenecarboximidamide |
| SMILES | O=S(=O)(N=C(Nc1nccs1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C14H11N3O2S3/c18-22(19,12-7-4-9-20-12)17-13(11-5-2-1-3-6-11)16-14-15-8-10-21-14/h1-10H,(H,15,16,17) |
| InChIKey | GWLQPSSYLVWOAM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|