C23H24N6O — CID 46909362
N-[3-[2-(quinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide (PubChem CID 46909362) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is N-[3-[2-(quinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[2-(quinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 46909362 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[3-[2-(quinolin-6-ylamino)pyrrolo[2,3-d]pyrimidin-7-yl]propyl]cyclobutanecarboxamide |
| SMILES | O=C(NCCCn1ccc2cnc(Nc3ccc4ncccc4c3)nc21)C1CCC1 |
| InChI | InChI=1S/C23H24N6O/c30-22(16-4-1-5-16)25-11-3-12-29-13-9-18-15-26-23(28-21(18)29)27-19-7-8-20-17(14-19)6-2-10-24-20/h2,6-10,13-16H,1,3-5,11-12H2,(H,25,30)(H,26,27,28) |
| InChIKey | SASKQCOPYLRNPM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|