C20H20N4O2S2 — CID 46909510
1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyridin-2-ylurea (PubChem CID 46909510) has the molecular formula C20H20N4O2S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyridin-2-ylurea.
| Compound Name | 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 46909510 |
| Molecular Formula | C20H20N4O2S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1-(6-oxospiro[1,3,4,10b-tetrahydropyrido[2,1-a]isoindole-2,2'-1,3-dithiolane]-10-yl)-3-pyridin-2-ylurea |
| SMILES | O=C(Nc1ccccn1)Nc1cccc2c1C1CC3(CCN1C2=O)SCCS3 |
| InChI | InChI=1S/C20H20N4O2S2/c25-18-13-4-3-5-14(22-19(26)23-16-6-1-2-8-21-16)17(13)15-12-20(7-9-24(15)18)27-10-11-28-20/h1-6,8,15H,7,9-12H2,(H2,21,22,23,26) |
| InChIKey | VYIRYOGIKCRYCM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |