C15H22ClNO2 — CID 46909844
[(1S)-1-(4-chlorophenyl)ethyl] N,N-di(propan-2-yl)carbamate (PubChem CID 46909844) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)ethyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(1S)-1-(4-chlorophenyl)ethyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 46909844 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)ethyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O[C@@H](C)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C15H22ClNO2/c1-10(2)17(11(3)4)15(18)19-12(5)13-6-8-14(16)9-7-13/h6-12H,1-5H3/t12-/m0/s1 |
| InChIKey | NKEDKLWCQFPMOA-LBPRGKRZSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |