C19H30O2 — CID 46914940
(1R,5R)-1-cyclohexyl-7-phenylheptane-1,5-diol (PubChem CID 46914940) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (1R,5R)-1-cyclohexyl-7-phenylheptane-1,5-diol.
| Compound Name | (1R,5R)-1-cyclohexyl-7-phenylheptane-1,5-diol |
|---|---|
| PubChem CID | 46914940 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (1R,5R)-1-cyclohexyl-7-phenylheptane-1,5-diol |
| SMILES | O[C@H](CCC[C@@H](O)C1CCCCC1)CCc1ccccc1 |
| InChI | InChI=1S/C19H30O2/c20-18(15-14-16-8-3-1-4-9-16)12-7-13-19(21)17-10-5-2-6-11-17/h1,3-4,8-9,17-21H,2,5-7,10-15H2/t18-,19-/m1/s1 |
| InChIKey | LHHUFMLAHDXGEP-RTBURBONSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |