C22H28ClN3O2 — CID 46914968
N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(naphthalen-1-ylmethyl)imidazol-3-ium-1-yl]acetamide chloride (PubChem CID 46914968) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(naphthalen-1-ylmethyl)imidazol-3-ium-1-yl]acetamide chloride.
| Compound Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(naphthalen-1-ylmethyl)imidazol-3-ium-1-yl]acetamide chloride |
|---|---|
| PubChem CID | 46914968 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(2S)-1-hydroxy-3,3-dimethylbutan-2-yl]-2-[3-(naphthalen-1-ylmethyl)imidazol-3-ium-1-yl]acetamide chloride |
| SMILES | CC(C)(C)[C@@H](CO)NC(=O)Cn1cc[n+](Cc2cccc3ccccc23)c1.[Cl-] |
| InChI | InChI=1S/C22H27N3O2.ClH/c1-22(2,3)20(15-26)23-21(27)14-25-12-11-24(16-25)13-18-9-6-8-17-7-4-5-10-19(17)18;/h4-12,16,20,26H,13-15H2,1-3H3;1H/t20-;/m1./s1 |
| InChIKey | ZPSVQJXVKPNZJD-VEIFNGETSA-N |
| XLogP | -0.50 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|