C15H24O3 — CID 46919357
(1S,2R,7R,8R,10R)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-ene-7,10-diol (PubChem CID 46919357) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,2R,7R,8R,10R)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-ene-7,10-diol.
| Compound Name | (1S,2R,7R,8R,10R)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-ene-7,10-diol |
|---|---|
| PubChem CID | 46919357 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,2R,7R,8R,10R)-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-ene-7,10-diol |
| SMILES | CC1=C2[C@@H](CC1)[C@]1(C)O[C@@](C(C)C)(C[C@H]1O)[C@@H]2O |
| InChI | InChI=1S/C15H24O3/c1-8(2)15-7-11(16)14(4,18-15)10-6-5-9(3)12(10)13(15)17/h8,10-11,13,16-17H,5-7H2,1-4H3/t10-,11-,13-,14+,15-/m1/s1 |
| InChIKey | FMBZOCYRCPPOTM-SOMZYNEFSA-N |
| XLogP | 2.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|