C32H43NO7 — CID 122635046
[1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-10-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 122635046) has the molecular formula C32H43NO7 and a molecular weight of 553.70 g/mol. Its IUPAC name is [1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-10-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | [1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-10-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 122635046 |
| Molecular Formula | C32H43NO7 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | [1,5-dimethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-5-en-10-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC1=C2C(CC1)C1(C)OC(C(C)C)(CC1OC(=O)C(C)NC(=O)OC(C)(C)C)C2OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C32H43NO7/c1-19(2)32-18-24(37-28(35)21(4)33-29(36)39-30(5,6)7)31(8,40-32)23-16-14-20(3)26(23)27(32)38-25(34)17-15-22-12-10-9-11-13-22/h9-13,15,17,19,21,23-24,27H,14,16,18H2,1-8H3,(H,33,36)/b17-15+ |
| InChIKey | ITBXIHVVYTZHPO-BMRADRMJSA-N |
| XLogP | 5.75 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|