C19H21Cl2N3O3S — CID 46919896
2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-4-phenylbutan-2-ylideneamino]acetamide (PubChem CID 46919896) has the molecular formula C19H21Cl2N3O3S and a molecular weight of 442.37 g/mol. Its IUPAC name is 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-4-phenylbutan-2-ylideneamino]acetamide.
| Compound Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-4-phenylbutan-2-ylideneamino]acetamide |
|---|---|
| PubChem CID | 46919896 |
| Molecular Formula | C19H21Cl2N3O3S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-(3,4-dichloro-N-methylsulfonylanilino)-N-[(E)-4-phenylbutan-2-ylideneamino]acetamide |
| SMILES | C/C(CCc1ccccc1)=N\NC(=O)CN(c1ccc(Cl)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H21Cl2N3O3S/c1-14(8-9-15-6-4-3-5-7-15)22-23-19(25)13-24(28(2,26)27)16-10-11-17(20)18(21)12-16/h3-7,10-12H,8-9,13H2,1-2H3,(H,23,25)/b22-14+ |
| InChIKey | FBACRMQZLGKMNU-HYARGMPZSA-N |
| XLogP | 3.88 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|