C24H24BrN3O3S — CID 4250371
2-[N-(benzenesulfonyl)-4-bromoanilino]-N-(4-phenylbutan-2-ylideneamino)acetamide (PubChem CID 4250371) has the molecular formula C24H24BrN3O3S and a molecular weight of 514.45 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-(4-phenylbutan-2-ylideneamino)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-(4-phenylbutan-2-ylideneamino)acetamide |
|---|---|
| PubChem CID | 4250371 |
| Molecular Formula | C24H24BrN3O3S |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-(4-phenylbutan-2-ylideneamino)acetamide |
| SMILES | CC(CCc1ccccc1)=NNC(=O)CN(c1ccc(Br)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24BrN3O3S/c1-19(12-13-20-8-4-2-5-9-20)26-27-24(29)18-28(22-16-14-21(25)15-17-22)32(30,31)23-10-6-3-7-11-23/h2-11,14-17H,12-13,18H2,1H3,(H,27,29) |
| InChIKey | ZVENKPQSKXNBJH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|