C21H24BrNO3 — CID 4692670
1-[(5-bromo-2-ethoxyphenyl)-phenylmethyl]piperidine-4-carboxylic acid (PubChem CID 4692670) has the molecular formula C21H24BrNO3 and a molecular weight of 418.33 g/mol. Its IUPAC name is 1-[(5-bromo-2-ethoxyphenyl)-phenylmethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-bromo-2-ethoxyphenyl)-phenylmethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4692670 |
| Molecular Formula | C21H24BrNO3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 1-[(5-bromo-2-ethoxyphenyl)-phenylmethyl]piperidine-4-carboxylic acid |
| SMILES | CCOc1ccc(Br)cc1C(c1ccccc1)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C21H24BrNO3/c1-2-26-19-9-8-17(22)14-18(19)20(15-6-4-3-5-7-15)23-12-10-16(11-13-23)21(24)25/h3-9,14,16,20H,2,10-13H2,1H3,(H,24,25) |
| InChIKey | LJYDCZYZEYIKGR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |