C23H24BrNO3S — CID 5169711
1-[1-benzothiophen-2-yl-(5-bromo-2-ethoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 5169711) has the molecular formula C23H24BrNO3S and a molecular weight of 474.42 g/mol. Its IUPAC name is 1-[1-benzothiophen-2-yl-(5-bromo-2-ethoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[1-benzothiophen-2-yl-(5-bromo-2-ethoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 5169711 |
| Molecular Formula | C23H24BrNO3S |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 1-[1-benzothiophen-2-yl-(5-bromo-2-ethoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCOc1ccc(Br)cc1C(c1cc2ccccc2s1)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C23H24BrNO3S/c1-2-28-19-8-7-17(24)14-18(19)22(25-11-9-15(10-12-25)23(26)27)21-13-16-5-3-4-6-20(16)29-21/h3-8,13-15,22H,2,9-12H2,1H3,(H,26,27) |
| InChIKey | GTQDRXVFGUYBNP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |