C21H23BrFNO3 — CID 5138377
1-[(5-bromo-2-ethoxyphenyl)-(3-fluorophenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 5138377) has the molecular formula C21H23BrFNO3 and a molecular weight of 436.32 g/mol. Its IUPAC name is 1-[(5-bromo-2-ethoxyphenyl)-(3-fluorophenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-bromo-2-ethoxyphenyl)-(3-fluorophenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 5138377 |
| Molecular Formula | C21H23BrFNO3 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 1-[(5-bromo-2-ethoxyphenyl)-(3-fluorophenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCOc1ccc(Br)cc1C(c1cccc(F)c1)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C21H23BrFNO3/c1-2-27-19-7-6-16(22)13-18(19)20(15-4-3-5-17(23)12-15)24-10-8-14(9-11-24)21(25)26/h3-7,12-14,20H,2,8-11H2,1H3,(H,25,26) |
| InChIKey | VUMHBEVMUTVHJO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |