C20H20N2O — CID 46928296
[(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone (PubChem CID 46928296) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone.
| Compound Name | [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone |
|---|---|
| PubChem CID | 46928296 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone |
| SMILES | NC(c1ccccc1)[C@@H]1CC[C@H]1C(=O)n1ccc2ccccc21 |
| InChI | InChI=1S/C20H20N2O/c21-19(15-7-2-1-3-8-15)16-10-11-17(16)20(23)22-13-12-14-6-4-5-9-18(14)22/h1-9,12-13,16-17,19H,10-11,21H2/t16-,17-,19?/m1/s1 |
| InChIKey | KWFZRSCEMMAIBT-QNZPCDNOSA-N |
| XLogP | 4.01 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |