About [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone
[(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone (PubChem CID 46928296) has the molecular formula C20H20N2O
and a molecular weight of 304.39 g/mol. Its IUPAC name is [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone.
Molecular Properties
| Compound Name | [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone |
| PubChem CID | 46928296 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone |
| SMILES | NC(c1ccccc1)[C@@H]1CC[C@H]1C(=O)n1ccc2ccccc21 |
| InChI | InChI=1S/C20H20N2O/c21-19(15-7-2-1-3-8-15)16-10-11-17(16)20(23)22-13-12-14-6-4-5-9-18(14)22/h1-9,12-13,16-17,19H,10-11,21H2/t16-,17-,19?/m1/s1 |
| InChIKey | KWFZRSCEMMAIBT-QNZPCDNOSA-N |
| XLogP | 4.01 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone?
The IUPAC name of [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone (CID 46928296) is [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone.
What is the SMILES notation for [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone?
The canonical SMILES for [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone is NC(c1ccccc1)[C@@H]1CC[C@H]1C(=O)n1ccc2ccccc21.
What is the InChIKey of [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone?
The InChIKey is KWFZRSCEMMAIBT-QNZPCDNOSA-N. The full InChI is InChI=1S/C20H20N2O/c21-19(15-7-2-1-3-8-15)16-10-11-17(16)20(23)22-13-12-14-6-4-5-9-18(14)22/h1-9,12-13,16-17,19H,10-11,21H2/t16-,17-,19?/m1/s1.
What are the key properties of [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone?
[(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone has a molecular weight of 304.39 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-[amino(phenyl)methyl]cyclobutyl]-indol-1-ylmethanone is sourced from PubChem (CID 46928296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).