C14H15NO3S — CID 10850154
2-(1,1-dioxothiolan-2-yl)-1-indol-1-ylethanone (PubChem CID 10850154) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-2-yl)-1-indol-1-ylethanone.
| Compound Name | 2-(1,1-dioxothiolan-2-yl)-1-indol-1-ylethanone |
|---|---|
| PubChem CID | 10850154 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-(1,1-dioxothiolan-2-yl)-1-indol-1-ylethanone |
| SMILES | O=C(CC1CCCS1(=O)=O)n1ccc2ccccc21 |
| InChI | InChI=1S/C14H15NO3S/c16-14(10-12-5-3-9-19(12,17)18)15-8-7-11-4-1-2-6-13(11)15/h1-2,4,6-8,12H,3,5,9-10H2 |
| InChIKey | LOKVHUXKGNUAAH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |