C14H16N2O — CID 141083697
N-cyclopentylindole-1-carboxamide (PubChem CID 141083697) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is N-cyclopentylindole-1-carboxamide.
| Compound Name | N-cyclopentylindole-1-carboxamide |
|---|---|
| PubChem CID | 141083697 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N-cyclopentylindole-1-carboxamide |
| SMILES | O=C(NC1CCCC1)n1ccc2ccccc21 |
| InChI | InChI=1S/C14H16N2O/c17-14(15-12-6-2-3-7-12)16-10-9-11-5-1-4-8-13(11)16/h1,4-5,8-10,12H,2-3,6-7H2,(H,15,17) |
| InChIKey | XMEBYBIJNQOBID-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |