C12H8F7N3O — CID 46928370
1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-4-amine (PubChem CID 46928370) has the molecular formula C12H8F7N3O and a molecular weight of 343.20 g/mol. Its IUPAC name is 1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-4-amine.
| Compound Name | 1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 46928370 |
| Molecular Formula | C12H8F7N3O |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-(4-ethoxy-2,3,5,6-tetrafluorophenyl)-5-(trifluoromethyl)pyrazol-4-amine |
| SMILES | CCOc1c(F)c(F)c(-n2ncc(N)c2C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C12H8F7N3O/c1-2-23-10-7(15)5(13)9(6(14)8(10)16)22-11(12(17,18)19)4(20)3-21-22/h3H,2,20H2,1H3 |
| InChIKey | TUYYDQIUQXGCEJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|