C23H18N4O2S — CID 46928853
3-(3-methylsulfanylphenyl)-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 46928853) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-(3-methylsulfanylphenyl)-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 3-(3-methylsulfanylphenyl)-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 46928853 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3-(3-methylsulfanylphenyl)-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | CSc1cccc(-c2[nH]nc3ncc4c(c23)C(=O)N(CCc2ccccc2)C4=O)c1 |
| InChI | InChI=1S/C23H18N4O2S/c1-30-16-9-5-8-15(12-16)20-19-18-17(13-24-21(19)26-25-20)22(28)27(23(18)29)11-10-14-6-3-2-4-7-14/h2-9,12-13H,10-11H2,1H3,(H,24,25,26) |
| InChIKey | LCPVIWZUEVAQHN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|