C20H19NO6 — CID 46929796
methyl 6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxoindole-3-carboxylate (PubChem CID 46929796) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is methyl 6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxoindole-3-carboxylate.
| Compound Name | methyl 6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxoindole-3-carboxylate |
|---|---|
| PubChem CID | 46929796 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl 6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-4,7-dioxoindole-3-carboxylate |
| SMILES | COC(=O)c1c2c(n(Cc3ccc(OC)cc3)c1C)C(=O)C(OC)=CC2=O |
| InChI | InChI=1S/C20H19NO6/c1-11-16(20(24)27-4)17-14(22)9-15(26-3)19(23)18(17)21(11)10-12-5-7-13(25-2)8-6-12/h5-9H,10H2,1-4H3 |
| InChIKey | IUVCXHSIISWPIO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|