C24H23NO3S — CID 46930111
[(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-naphthalen-2-ylmethanone (PubChem CID 46930111) has the molecular formula C24H23NO3S and a molecular weight of 405.52 g/mol. Its IUPAC name is [(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-naphthalen-2-ylmethanone.
| Compound Name | [(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 46930111 |
| Molecular Formula | C24H23NO3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [(3S,4R)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]-naphthalen-2-ylmethanone |
| SMILES | C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H23NO3S/c1-3-18-15-25(29(27,28)22-12-8-17(2)9-13-22)16-23(18)24(26)21-11-10-19-6-4-5-7-20(19)14-21/h3-14,18,23H,1,15-16H2,2H3/t18-,23+/m0/s1 |
| InChIKey | FRVRJGSGVBWAKK-FDDCHVKYSA-N |
| XLogP | 4.45 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|