C15H22N2O5 — CID 46930333
(E)-but-2-enedioic acid;1-[2-methoxy-2-(3-methylphenyl)ethyl]-1-methylhydrazine (PubChem CID 46930333) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-methoxy-2-(3-methylphenyl)ethyl]-1-methylhydrazine.
| Compound Name | (E)-but-2-enedioic acid;1-[2-methoxy-2-(3-methylphenyl)ethyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 46930333 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-methoxy-2-(3-methylphenyl)ethyl]-1-methylhydrazine |
| SMILES | COC(CN(C)N)c1cccc(C)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C11H18N2O.C4H4O4/c1-9-5-4-6-10(7-9)11(14-3)8-13(2)12;5-3(6)1-2-4(7)8/h4-7,11H,8,12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XBZYGRXYZDCASS-WLHGVMLRSA-N |
| XLogP | 1.20 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|