C18H16BrClN2O2 — CID 46934621
4-(3-bromopropoxy)-N-(2-chlorophenyl)-1H-indole-2-carboxamide (PubChem CID 46934621) has the molecular formula C18H16BrClN2O2 and a molecular weight of 407.70 g/mol. Its IUPAC name is 4-(3-bromopropoxy)-N-(2-chlorophenyl)-1H-indole-2-carboxamide.
| Compound Name | 4-(3-bromopropoxy)-N-(2-chlorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46934621 |
| Molecular Formula | C18H16BrClN2O2 |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4-(3-bromopropoxy)-N-(2-chlorophenyl)-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cc2c(OCCCBr)cccc2[nH]1 |
| InChI | InChI=1S/C18H16BrClN2O2/c19-9-4-10-24-17-8-3-7-14-12(17)11-16(21-14)18(23)22-15-6-2-1-5-13(15)20/h1-3,5-8,11,21H,4,9-10H2,(H,22,23) |
| InChIKey | UEEYMVKMRDEEIF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|