C14H11ClN4O3 — CID 46260719
1-(2-chlorophenyl)-3-(4H-furo[3,2-b]pyrrole-5-carbonylamino)urea (PubChem CID 46260719) has the molecular formula C14H11ClN4O3 and a molecular weight of 318.72 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(4H-furo[3,2-b]pyrrole-5-carbonylamino)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(4H-furo[3,2-b]pyrrole-5-carbonylamino)urea |
|---|---|
| PubChem CID | 46260719 |
| Molecular Formula | C14H11ClN4O3 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(4H-furo[3,2-b]pyrrole-5-carbonylamino)urea |
| SMILES | O=C(NNC(=O)c1cc2occc2[nH]1)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H11ClN4O3/c15-8-3-1-2-4-9(8)17-14(21)19-18-13(20)11-7-12-10(16-11)5-6-22-12/h1-7,16H,(H,18,20)(H2,17,19,21) |
| InChIKey | DEUFJXHOKWMDNS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|