C18H13FN3O3S- — CID 4693540
4-[(3-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzenecarboximidate (PubChem CID 4693540) has the molecular formula C18H13FN3O3S- and a molecular weight of 370.39 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzenecarboximidate.
| Compound Name | 4-[(3-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzenecarboximidate |
|---|---|
| PubChem CID | 4693540 |
| Molecular Formula | C18H13FN3O3S- |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 4-[(3-fluorophenyl)sulfonylamino]-N-pyridin-4-ylbenzenecarboximidate |
| SMILES | O=S(=O)(Nc1ccc(/C([O-])=N/c2ccncc2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H14FN3O3S/c19-14-2-1-3-17(12-14)26(24,25)22-16-6-4-13(5-7-16)18(23)21-15-8-10-20-11-9-15/h1-12,22H,(H,20,21,23)/p-1 |
| InChIKey | PBUJLMUIUBGDBA-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|