C10H15N4O5+ — CID 46936556
(2R,3R,4R,5S)-2-[(6R)-6-hydroxy-6,7-dihydro-3H-purin-9-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 46936556) has the molecular formula C10H15N4O5+ and a molecular weight of 271.25 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[(6R)-6-hydroxy-6,7-dihydro-3H-purin-9-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[(6R)-6-hydroxy-6,7-dihydro-3H-purin-9-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 46936556 |
| Molecular Formula | C10H15N4O5+ |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R,3R,4R,5S)-2-[(6R)-6-hydroxy-6,7-dihydro-3H-purin-9-ium-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@@H]1O[C@@H]([n+]2c[nH]c3c2NC=N[C@@H]3O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,9-10,15-18H,1H2,(H,11,12)/p+1/t4-,6-,7+,9+,10+/m0/s1 |
| InChIKey | WGRXVKRHIMUTPD-DGCCPWOOSA-O |
| XLogP | -2.64 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|