C24H24ClFN2O2 — CID 46937488
N-(2-chloro-4-fluorophenyl)-N-cyclopentyl-2-isoquinolin-5-yloxy-2-methylpropanamide (PubChem CID 46937488) has the molecular formula C24H24ClFN2O2 and a molecular weight of 426.92 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-N-cyclopentyl-2-isoquinolin-5-yloxy-2-methylpropanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-N-cyclopentyl-2-isoquinolin-5-yloxy-2-methylpropanamide |
|---|---|
| PubChem CID | 46937488 |
| Molecular Formula | C24H24ClFN2O2 |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-N-cyclopentyl-2-isoquinolin-5-yloxy-2-methylpropanamide |
| SMILES | CC(C)(Oc1cccc2cnccc12)C(=O)N(c1ccc(F)cc1Cl)C1CCCC1 |
| InChI | InChI=1S/C24H24ClFN2O2/c1-24(2,30-22-9-5-6-16-15-27-13-12-19(16)22)23(29)28(18-7-3-4-8-18)21-11-10-17(26)14-20(21)25/h5-6,9-15,18H,3-4,7-8H2,1-2H3 |
| InChIKey | HORUNRFSJHPWID-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |