C11H15ClN3S+ — CID 4693980
1-(3-chlorophenyl)-5-ethyl-1,3,5-triazinan-5-ium-2-thione (PubChem CID 4693980) has the molecular formula C11H15ClN3S+ and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-ethyl-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 1-(3-chlorophenyl)-5-ethyl-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 4693980 |
| Molecular Formula | C11H15ClN3S+ |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-(3-chlorophenyl)-5-ethyl-1,3,5-triazinan-5-ium-2-thione |
| SMILES | CC[NH+]1CNC(=S)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C11H14ClN3S/c1-2-14-7-13-11(16)15(8-14)10-5-3-4-9(12)6-10/h3-6H,2,7-8H2,1H3,(H,13,16)/p+1 |
| InChIKey | RSLIRLZMPURFRN-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|