C9H10ClN3S — CID 15056559
1-(3-chlorophenyl)-1,2,4-triazinane-3-thione (PubChem CID 15056559) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1,2,4-triazinane-3-thione.
| Compound Name | 1-(3-chlorophenyl)-1,2,4-triazinane-3-thione |
|---|---|
| PubChem CID | 15056559 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 1-(3-chlorophenyl)-1,2,4-triazinane-3-thione |
| SMILES | S=C1NCCN(c2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C9H10ClN3S/c10-7-2-1-3-8(6-7)13-5-4-11-9(14)12-13/h1-3,6H,4-5H2,(H2,11,12,14) |
| InChIKey | WWEPUUWCMOXFAE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|