C9H8Cl2N2 — CID 84680740
5-chloro-2-(3-chlorophenyl)-3,4-dihydropyrazole (PubChem CID 84680740) has the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. Its IUPAC name is 5-chloro-2-(3-chlorophenyl)-3,4-dihydropyrazole.
| Compound Name | 5-chloro-2-(3-chlorophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 84680740 |
| Molecular Formula | C9H8Cl2N2 |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 5-chloro-2-(3-chlorophenyl)-3,4-dihydropyrazole |
| SMILES | ClC1=NN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C9H8Cl2N2/c10-7-2-1-3-8(6-7)13-5-4-9(11)12-13/h1-3,6H,4-5H2 |
| InChIKey | AABXGTVSCZDZLX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |