C17H24O4 — CID 46939890
[(1R,4S,6R,9E,11S)-9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl]methyl acetate (PubChem CID 46939890) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(1R,4S,6R,9E,11S)-9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl]methyl acetate.
| Compound Name | [(1R,4S,6R,9E,11S)-9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl]methyl acetate |
|---|---|
| PubChem CID | 46939890 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(1R,4S,6R,9E,11S)-9-formyl-12,12-dimethyl-5-oxatricyclo[9.1.0.04,6]dodec-9-en-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12CC[C@@H]3[C@H](/C=C(/C=O)CC[C@H]1O2)C3(C)C |
| InChI | InChI=1S/C17H24O4/c1-11(19)20-10-17-7-6-13-14(16(13,2)3)8-12(9-18)4-5-15(17)21-17/h8-9,13-15H,4-7,10H2,1-3H3/b12-8+/t13-,14+,15-,17+/m1/s1 |
| InChIKey | UFFUHXLOFAGFNB-KBBMYKIPSA-N |
| XLogP | 2.66 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|