C22H16Cl2F3NO3 — CID 46940023
3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]benzoic acid (PubChem CID 46940023) has the molecular formula C22H16Cl2F3NO3 and a molecular weight of 470.27 g/mol. Its IUPAC name is 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]benzoic acid.
| Compound Name | 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 46940023 |
| Molecular Formula | C22H16Cl2F3NO3 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]benzoic acid |
| SMILES | CC(c1ccc(-c2cccc(C(=O)O)c2)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C22H16Cl2F3NO3/c1-12(21(31,22(25,26)27)16-7-8-28-19(24)11-16)17-6-5-14(10-18(17)23)13-3-2-4-15(9-13)20(29)30/h2-12,31H,1H3,(H,29,30) |
| InChIKey | WPDUPPBUVQFXQF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|