C23H19Cl2F3N2O3 — CID 46941259
3-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]methylamino]benzoic acid (PubChem CID 46941259) has the molecular formula C23H19Cl2F3N2O3 and a molecular weight of 499.32 g/mol. Its IUPAC name is 3-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]methylamino]benzoic acid.
| Compound Name | 3-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 46941259 |
| Molecular Formula | C23H19Cl2F3N2O3 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 3-[[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]methylamino]benzoic acid |
| SMILES | CC(c1ccc(CNc2cccc(C(=O)O)c2)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C23H19Cl2F3N2O3/c1-13(22(33,23(26,27)28)16-7-8-29-20(25)11-16)18-6-5-14(9-19(18)24)12-30-17-4-2-3-15(10-17)21(31)32/h2-11,13,30,33H,12H2,1H3,(H,31,32) |
| InChIKey | KIJUIQCYWCBEQR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|