C16H14Cl2F3NO2 — CID 57421263
3-(2-chloro-4-methoxyphenyl)-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 57421263) has the molecular formula C16H14Cl2F3NO2 and a molecular weight of 380.19 g/mol. Its IUPAC name is 3-(2-chloro-4-methoxyphenyl)-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 3-(2-chloro-4-methoxyphenyl)-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 57421263 |
| Molecular Formula | C16H14Cl2F3NO2 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 3-(2-chloro-4-methoxyphenyl)-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | COc1ccc(C(C)C(O)(c2ccnc(Cl)c2)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2F3NO2/c1-9(12-4-3-11(24-2)8-13(12)17)15(23,16(19,20)21)10-5-6-22-14(18)7-10/h3-9,23H,1-2H3 |
| InChIKey | IVNCDYJFRMCQMP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|