C20H20Cl2F3NO3 — CID 86629103
ethyl 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoate (PubChem CID 86629103) has the molecular formula C20H20Cl2F3NO3 and a molecular weight of 450.28 g/mol. Its IUPAC name is ethyl 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoate.
| Compound Name | ethyl 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 86629103 |
| Molecular Formula | C20H20Cl2F3NO3 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | ethyl 3-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(C(C)C(O)(c2ccnc(Cl)c2)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2F3NO3/c1-3-29-18(27)7-5-13-4-6-15(16(21)10-13)12(2)19(28,20(23,24)25)14-8-9-26-17(22)11-14/h4,6,8-12,28H,3,5,7H2,1-2H3 |
| InChIKey | AOKUYZDXCNECEA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|