C23H20Cl2F3NO3 — CID 90722235
3-[2-chloro-4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 90722235) has the molecular formula C23H20Cl2F3NO3 and a molecular weight of 486.32 g/mol. Its IUPAC name is 3-[2-chloro-4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 3-[2-chloro-4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 90722235 |
| Molecular Formula | C23H20Cl2F3NO3 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 3-[2-chloro-4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-2-(2-chloro-4-pyridinyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | CC(c1ccc(OCc2ccc(CO)cc2)cc1Cl)C(O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C23H20Cl2F3NO3/c1-14(22(31,23(26,27)28)17-8-9-29-21(25)10-17)19-7-6-18(11-20(19)24)32-13-16-4-2-15(12-30)3-5-16/h2-11,14,30-31H,12-13H2,1H3 |
| InChIKey | ZLWYMTAZKCENRH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|