C23H18Cl2F3NO5 — CID 46940555
4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]-2-methoxybenzoic acid (PubChem CID 46940555) has the molecular formula C23H18Cl2F3NO5 and a molecular weight of 516.30 g/mol. Its IUPAC name is 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]-2-methoxybenzoic acid.
| Compound Name | 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 46940555 |
| Molecular Formula | C23H18Cl2F3NO5 |
| Molecular Weight | 516.30 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 4-[3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]-2-methoxybenzoic acid |
| SMILES | COc1cc(Oc2ccc(C(C)C(O)(c3ccnc(Cl)c3)C(F)(F)F)c(Cl)c2)ccc1C(=O)O |
| InChI | InChI=1S/C23H18Cl2F3NO5/c1-12(22(32,23(26,27)28)13-7-8-29-20(25)9-13)16-5-3-14(10-18(16)24)34-15-4-6-17(21(30)31)19(11-15)33-2/h3-12,32H,1-2H3,(H,30,31) |
| InChIKey | NAOXTJKPQJBOHE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.30 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|