C25H21Cl2F3N2O6S — CID 59507385
2-chloro-4-[3-chloro-4-[(2S,3S)-3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid (PubChem CID 59507385) has the molecular formula C25H21Cl2F3N2O6S and a molecular weight of 605.42 g/mol. Its IUPAC name is 2-chloro-4-[3-chloro-4-[(2S,3S)-3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid.
| Compound Name | 2-chloro-4-[3-chloro-4-[(2S,3S)-3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 59507385 |
| Molecular Formula | C25H21Cl2F3N2O6S |
| Molecular Weight | 605.42 g/mol |
| Exact Mass | 604.04 |
| IUPAC Name | 2-chloro-4-[3-chloro-4-[(2S,3S)-3-(1,3-dimethyl-2,2-dioxo-2λ6,1,3-benzothiadiazol-5-yl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenoxy]benzoic acid |
| SMILES | C[C@@H](c1ccc(Oc2ccc(C(=O)O)c(Cl)c2)cc1Cl)[C@](O)(c1ccc2c(c1)N(C)S(=O)(=O)N2C)C(F)(F)F |
| InChI | InChI=1S/C25H21Cl2F3N2O6S/c1-13(17-7-5-15(11-19(17)26)38-16-6-8-18(23(33)34)20(27)12-16)24(35,25(28,29)30)14-4-9-21-22(10-14)32(3)39(36,37)31(21)2/h4-13,35H,1-3H3,(H,33,34)/t13-,24-/m0/s1 |
| InChIKey | AVNSZVVADZEKEG-RZFZLAGVSA-N |
| XLogP | 6.17 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |