C18H15Cl5F3NO6S — CID 158054593
methyl 3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoate;trichloromethanesulfonic acid (PubChem CID 158054593) has the molecular formula C18H15Cl5F3NO6S and a molecular weight of 607.65 g/mol. Its IUPAC name is methyl 3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoate;trichloromethanesulfonic acid.
| Compound Name | methyl 3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoate;trichloromethanesulfonic acid |
|---|---|
| PubChem CID | 158054593 |
| Molecular Formula | C18H15Cl5F3NO6S |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 604.90 |
| IUPAC Name | methyl 3-chloro-4-[3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]benzoate;trichloromethanesulfonic acid |
| SMILES | COC(=O)c1ccc(C(C)C(O)(c2ccnc(Cl)c2)C(F)(F)F)c(Cl)c1.O=S(=O)(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H14Cl2F3NO3.CHCl3O3S/c1-9(12-4-3-10(7-13(12)18)15(24)26-2)16(25,17(20,21)22)11-5-6-23-14(19)8-11;2-1(3,4)8(5,6)7/h3-9,25H,1-2H3;(H,5,6,7) |
| InChIKey | FJWRBDDUZPJOSA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|