C10H23N3O2S — CID 46942380
(2S)-2-amino-5-[[(1R)-1-amino-1-sulfanylpentyl]amino]pentanoic acid (PubChem CID 46942380) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(1R)-1-amino-1-sulfanylpentyl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(1R)-1-amino-1-sulfanylpentyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 46942380 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2S)-2-amino-5-[[(1R)-1-amino-1-sulfanylpentyl]amino]pentanoic acid |
| SMILES | CCCC[C@](N)(S)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H23N3O2S/c1-2-3-6-10(12,16)13-7-4-5-8(11)9(14)15/h8,13,16H,2-7,11-12H2,1H3,(H,14,15)/t8-,10+/m0/s1 |
| InChIKey | STJHDENRTDICHR-WCBMZHEXSA-N |
| XLogP | 0.50 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|