C18H19N3O7S — CID 46943452
N-(5-methyl-1,2-oxazol-3-yl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-benzothiazole-5-carboxamide (PubChem CID 46943452) has the molecular formula C18H19N3O7S and a molecular weight of 421.43 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 46943452 |
| Molecular Formula | C18H19N3O7S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3-benzothiazole-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3sc([C@@H]4O[C@H](CO)[C@H](O)[C@H](O)[C@H]4O)nc3c2)no1 |
| InChI | InChI=1S/C18H19N3O7S/c1-7-4-12(21-28-7)20-17(26)8-2-3-11-9(5-8)19-18(29-11)16-15(25)14(24)13(23)10(6-22)27-16/h2-5,10,13-16,22-25H,6H2,1H3,(H,20,21,26)/t10-,13+,14+,15-,16-/m1/s1 |
| InChIKey | NKAJPGYUQBNNDQ-NVAJDRRBSA-N |
| XLogP | 0.36 |
| TPSA | 158.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |