C18H20N2O6 — CID 46944533
1-O-tert-butyl 3-O-ethyl 5-(4-nitrophenyl)pyrrole-1,3-dicarboxylate (PubChem CID 46944533) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 5-(4-nitrophenyl)pyrrole-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 5-(4-nitrophenyl)pyrrole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46944533 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 5-(4-nitrophenyl)pyrrole-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)n(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H20N2O6/c1-5-25-16(21)13-10-15(12-6-8-14(9-7-12)20(23)24)19(11-13)17(22)26-18(2,3)4/h6-11H,5H2,1-4H3 |
| InChIKey | CPJJJXGPOURYJQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|