C16H12N4 — CID 46945880
4-benzyl-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 46945880) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-benzyl-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 4-benzyl-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 46945880 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-benzyl-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | c1ccc(Cc2nc3ccccc3n3cnnc23)cc1 |
| InChI | InChI=1S/C16H12N4/c1-2-6-12(7-3-1)10-14-16-19-17-11-20(16)15-9-5-4-8-13(15)18-14/h1-9,11H,10H2 |
| InChIKey | QEOMUNIOZPWFSQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |