C19H28O3 — CID 46947114
[(1S,8aS)-8a-methyl-6-oxo-5-prop-2-enyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate (PubChem CID 46947114) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is [(1S,8aS)-8a-methyl-6-oxo-5-prop-2-enyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,8aS)-8a-methyl-6-oxo-5-prop-2-enyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 46947114 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [(1S,8aS)-8a-methyl-6-oxo-5-prop-2-enyl-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
| SMILES | C=CCC1=C2CCC[C@H](OC(=O)C(C)(C)C)[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C19H28O3/c1-6-8-13-14-9-7-10-16(22-17(21)18(2,3)4)19(14,5)12-11-15(13)20/h6,16H,1,7-12H2,2-5H3/t16-,19-/m0/s1 |
| InChIKey | ZMSXZFMZBUIIOV-LPHOPBHVSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|