C25H30N4O5 — CID 46950067
3-[[4-(4-acetylpiperazin-1-yl)anilino]methyl]-5,6,7-trimethoxy-1H-quinolin-2-one (PubChem CID 46950067) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 3-[[4-(4-acetylpiperazin-1-yl)anilino]methyl]-5,6,7-trimethoxy-1H-quinolin-2-one.
| Compound Name | 3-[[4-(4-acetylpiperazin-1-yl)anilino]methyl]-5,6,7-trimethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 46950067 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-[[4-(4-acetylpiperazin-1-yl)anilino]methyl]-5,6,7-trimethoxy-1H-quinolin-2-one |
| SMILES | COc1cc2[nH]c(=O)c(CNc3ccc(N4CCN(C(C)=O)CC4)cc3)cc2c(OC)c1OC |
| InChI | InChI=1S/C25H30N4O5/c1-16(30)28-9-11-29(12-10-28)19-7-5-18(6-8-19)26-15-17-13-20-21(27-25(17)31)14-22(32-2)24(34-4)23(20)33-3/h5-8,13-14,26H,9-12,15H2,1-4H3,(H,27,31) |
| InChIKey | MCBFYVKZNUFBSF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|